CAS 525596-98-9 is the registry number for (E)-4-(3-(4-Chlorophenyl)-3-oxoprop-1-en-1-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]benzoic acid (CAS 525596-98-9) is a chemical compound with the molecular formula C16H11ClO3 and a molecular weight of 286.71 g/mol. IUPAC name: 4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: LOYDPLGHYGKNBM-XCVCLJGOSA-N.
| Molecular formula | C16H11ClO3 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | LOYDPLGHYGKNBM-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)