CAS 328019-68-7 is the registry number for 3-(2-Chloro-phenyl)-7-hydroxy-2-methyl-chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(2-chlorophenyl)-7-hydroxy-2-methylchromen-4-one (CAS 328019-68-7) is a chemical compound with the molecular formula C16H11ClO3 and a molecular weight of 286.71 g/mol. IUPAC name: 3-(2-chlorophenyl)-7-hydroxy-2-methylchromen-4-one. InChIKey: WEDRCDZEHNPGMA-UHFFFAOYSA-N.
| Molecular formula | C16H11ClO3 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-7-hydroxy-2-methylchromen-4-one |
| InChIKey | WEDRCDZEHNPGMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(O1)C=C(C=C2)O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)