CAS 2206741-47-9 is the registry number for Benzyl (2S,5R)-2-(cyanomethyl)-5-methylpiperazine-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,5R)-2-(cyanomethyl)-5-methylpiperazine-1-carboxylate;hydrochloride (CAS 2206741-47-9) is a chemical compound with the molecular formula C15H20ClN3O2 and a molecular weight of 309.79 g/mol. IUPAC name: benzyl (2S,5R)-2-(cyanomethyl)-5-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: KZZXTUYIUBIAAO-OJMBIDBESA-N.
| Molecular formula | C15H20ClN3O2 |
|---|---|
| Molecular weight | 309.79 g/mol |
| IUPAC name | benzyl (2S,5R)-2-(cyanomethyl)-5-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | KZZXTUYIUBIAAO-OJMBIDBESA-N |
| SMILES | C[C@@H]1CN([C@H](CN1)CC#N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)