Products 2641512-77-6
CAS 2641512-77-6 appears in our catalog under these names: CRBN ligand-394, 99.77%, 3-(4-(Piperazin-1-yl)phenyl)piperidine-2,6-dione hydrochloride, 98%. Offered by: MedChemExpress, Fluorochem, Chemat. Available pack sizes: 25 mg, 50 mg, 250 mg, 1 g, 500 mg, 10 mg, 5 mg, 100 mg.
3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;hydrochloride (CAS 2641512-77-6) is a chemical compound with the molecular formula C15H20ClN3O2 and a molecular weight of 309.79 g/mol. IUPAC name: 3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;hydrochloride. InChIKey: PQHQZXQEXXBLMD-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O2 |
|---|---|
| Molecular weight | 309.79 g/mol |
| IUPAC name | 3-(4-piperazin-1-ylphenyl)piperidine-2,6-dione;hydrochloride |
| InChIKey | PQHQZXQEXXBLMD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)N3CCNCC3.Cl |
Computed by PubChem (NCBI)