Products 912763-54-3
CAS 912763-54-3 is the registry number for 4-Chloro-N-(1-(N-hydroxycarbamimidoyl)cycloheptyl)benzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide (CAS 912763-54-3) is a chemical compound with the molecular formula C15H20ClN3O2 and a molecular weight of 309.79 g/mol. IUPAC name: 4-chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide. InChIKey: ARZSTOMYNLXBSB-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O2 |
|---|---|
| Molecular weight | 309.79 g/mol |
| IUPAC name | 4-chloro-N-[1-(N'-hydroxycarbamimidoyl)cycloheptyl]benzamide |
| InChIKey | ARZSTOMYNLXBSB-UHFFFAOYSA-N |
| SMILES | C1CCCC(CC1)(C(=NO)N)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)