CAS 220675-94-5 appears in our catalog under these names: 1-(3,5-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol, 98%, 1–(3,5–dimethylphenyl)–2,2,2–trifluoroethan–1–ol, 1-(3,5-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol, 1-(3,5-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g, 50mg, 10g, 500mg, 2.5g.
1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanol (CAS 220675-94-5) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanol. InChIKey: DQTXEAKXIGCGEJ-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | DQTXEAKXIGCGEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C(F)(F)F)O)C |
Computed by PubChem (NCBI)