Products 220728-17-6
CAS 220728-17-6 is the registry number for UCL-1972. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5-(4-nitrophenoxy)pentyl]pyrrolidine (CAS 220728-17-6) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: 1-[5-(4-nitrophenoxy)pentyl]pyrrolidine. InChIKey: ITOJPDNONZGUKB-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | 1-[5-(4-nitrophenoxy)pentyl]pyrrolidine |
| InChIKey | ITOJPDNONZGUKB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCCCCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)