CAS 2208275-23-2 is the registry number for Rel-(1S,3R,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo(2.2.1)heptane hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1S,3R,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride (CAS 2208275-23-2) is a chemical compound with the molecular formula C6H9ClF3NO and a molecular weight of 203.59 g/mol. IUPAC name: (1S,3R,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride. InChIKey: BYOXZPKKLYRPCG-ASMLCRKRSA-N.
| Molecular formula | C6H9ClF3NO |
|---|---|
| Molecular weight | 203.59 g/mol |
| IUPAC name | (1S,3R,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
| InChIKey | BYOXZPKKLYRPCG-ASMLCRKRSA-N |
| SMILES | C1[C@H]2CN[C@@H]1[C@@H](O2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)