Products 2624131-80-0
CAS 2624131-80-0 appears in our catalog under these names: 1-(Trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-amine hydrochloride, 98%, 1-(Trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-amine hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride (CAS 2624131-80-0) is a chemical compound with the molecular formula C6H9ClF3NO and a molecular weight of 203.59 g/mol. IUPAC name: 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride. InChIKey: IBUWLIUWVOKJPG-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3NO |
|---|---|
| Molecular weight | 203.59 g/mol |
| IUPAC name | 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride |
| InChIKey | IBUWLIUWVOKJPG-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(OC2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)