Products 2504147-27-5
CAS 2504147-27-5 is the registry number for (1S,3S,4S)-3-(Trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(1S,3S,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride (CAS 2504147-27-5) is a chemical compound with the molecular formula C6H9ClF3NO and a molecular weight of 203.59 g/mol. IUPAC name: (1S,3S,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride. InChIKey: BYOXZPKKLYRPCG-SHLRHQAISA-N.
| Molecular formula | C6H9ClF3NO |
|---|---|
| Molecular weight | 203.59 g/mol |
| IUPAC name | (1S,3S,4S)-3-(trifluoromethyl)-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
| InChIKey | BYOXZPKKLYRPCG-SHLRHQAISA-N |
| SMILES | C1[C@H]2CN[C@@H]1[C@H](O2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)