Products 2749760-54-9
CAS 2749760-54-9 is the registry number for (1-Chloro-6-fluoroisoquinolin-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-chloro-6-fluoroisoquinolin-5-yl)methanol (CAS 2749760-54-9) is a chemical compound with the molecular formula C10H7ClFNO and a molecular weight of 211.62 g/mol. IUPAC name: (1-chloro-6-fluoroisoquinolin-5-yl)methanol. InChIKey: PUFSBCJLRLNALV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | (1-chloro-6-fluoroisoquinolin-5-yl)methanol |
| InChIKey | PUFSBCJLRLNALV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=NC=C2)Cl)CO)F |
Computed by PubChem (NCBI)