Products 22095-98-3
CAS 22095-98-3 appears in our catalog under these names: (4–(4–aminobenzoyl)oxyphenyl) 4–aminobenzoate, 1,4-Phenylene Bis(4-aminobenzoate), >95.0%(HPLC)(qNMR), [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate, 97%, 97%, [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate, 97%, 1,4-Phenylene bis(4-aminobenzoate), 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
[4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate (CAS 22095-98-3) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate. InChIKey: FPXWISWMBLVKOD-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate |
| InChIKey | FPXWISWMBLVKOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)OC(=O)C3=CC=C(C=C3)N)N |
Computed by PubChem (NCBI)