Products 220984-26-9
CAS 220984-26-9 is the registry number for Detiviciclovir. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol (CAS 220984-26-9) is a chemical compound with the molecular formula C9H13N5O2 and a molecular weight of 223.23 g/mol. IUPAC name: 2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol. InChIKey: PIWJGZWZNOWIGH-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol |
| InChIKey | PIWJGZWZNOWIGH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C=N2)CC(CO)CO |
Computed by PubChem (NCBI)