CAS 5426-47-1 is the registry number for 8-(Dimethylamino)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(dimethylamino)-1,3-dimethyl-7H-purine-2,6-dione (CAS 5426-47-1) is a chemical compound with the molecular formula C9H13N5O2 and a molecular weight of 223.23 g/mol. IUPAC name: 8-(dimethylamino)-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: QOFFIYLUCIEBBX-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 8-(dimethylamino)-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | QOFFIYLUCIEBBX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)N(C)C |
Computed by PubChem (NCBI)