CAS 35206-02-1 appears in our catalog under these names: 7-(2-Aminoethyl)theophylline, 97%, 97%, 7-(2-Aminoethyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione (CAS 35206-02-1) is a chemical compound with the molecular formula C9H13N5O2 and a molecular weight of 223.23 g/mol. IUPAC name: 7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione. InChIKey: XUTQHTZFMFGXDJ-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 7-(2-aminoethyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | XUTQHTZFMFGXDJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCN |
Computed by PubChem (NCBI)