Products 2212305-01-4
CAS 2212305-01-4 is the registry number for 2–Ethoxy–3–acetonyltaxifolin. Offered by: GLPBio. Available pack sizes: 5mg.
2-(3,4-dihydroxyphenyl)-2-ethoxy-3,5,7-trihydroxy-3-(2-oxopropyl)chromen-4-one (CAS 2212305-01-4) is a chemical compound with the molecular formula C20H20O9 and a molecular weight of 404.4 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-2-ethoxy-3,5,7-trihydroxy-3-(2-oxopropyl)chromen-4-one. InChIKey: MKRMEFNBLYQLBI-UHFFFAOYSA-N.
| Molecular formula | C20H20O9 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-2-ethoxy-3,5,7-trihydroxy-3-(2-oxopropyl)chromen-4-one |
| InChIKey | MKRMEFNBLYQLBI-UHFFFAOYSA-N |
| SMILES | CCOC1(C(C(=O)C2=C(C=C(C=C2O1)O)O)(CC(=O)C)O)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Ethoxy-3-acetonyltaxifolin, orb1680485