Products 29550-05-8
CAS 29550-05-8 is the registry number for Gardenin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one (CAS 29550-05-8) is a chemical compound with the molecular formula C20H20O9 and a molecular weight of 404.4 g/mol. IUPAC name: 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one. InChIKey: FWJPIXFUGYRDQG-UHFFFAOYSA-N.
| Molecular formula | C20H20O9 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7,8-trimethoxychromen-4-one |
| InChIKey | FWJPIXFUGYRDQG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)C2=CC(=O)C3=C(C(=C(C(=C3O2)OC)OC)OC)O |
Computed by PubChem (NCBI)