Products 71607-32-4
CAS 71607-32-4 appears in our catalog under these names: Di-p-toluoyl-L-tartaric acid monohydrate 99%, Di-p-toluoyl-L-tartaric acid monohydrate, 99%, 99%, Di-p-toluoyl-L-tartaric acid monohydrate, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1000g, 1kg, 25g, 100g, 200g, 300g, 400g, 500g.
(2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;hydrate (CAS 71607-32-4) is a chemical compound with the molecular formula C20H20O9 and a molecular weight of 404.4 g/mol. IUPAC name: (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;hydrate. InChIKey: FOTRUJUPLHRVNU-QNBGGDODSA-N.
| Molecular formula | C20H20O9 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;hydrate |
| InChIKey | FOTRUJUPLHRVNU-QNBGGDODSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]([C@H](C(=O)O)OC(=O)C2=CC=C(C=C2)C)C(=O)O.O |
Computed by PubChem (NCBI)