CAS 221241-31-2 appears in our catalog under these names: 2,5-Dibromo-4-nitropyridine 98%, 2,5-Dibromo-4-nitropyridine, >95%, >95%, 2,5-Dibromo-4-nitropyridine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g.
2,5-dibromo-4-nitropyridine (CAS 221241-31-2) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,5-dibromo-4-nitropyridine. InChIKey: QQNCRXJHMWJGQK-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,5-dibromo-4-nitropyridine |
| InChIKey | QQNCRXJHMWJGQK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)