CAS 55304-80-8 appears in our catalog under these names: 2,6–dibromo–3–nitropyridine, 2,6-Dibromo-3-nitropyridine, 2,6-Dibromo-3-nitropyridine 97%, 2,6-Dibromo-3-nitropyridine, 95%, 95%, 2,6-Dibromo-3-nitropyridine, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1000g, 5g, 10g, 500g, 1g.
2,6-dibromo-3-nitropyridine (CAS 55304-80-8) is a chemical compound with the molecular formula C5H2Br2N2O2 and a molecular weight of 281.89 g/mol. IUPAC name: 2,6-dibromo-3-nitropyridine. InChIKey: FFRFTURYWWFKIC-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2N2O2 |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | 2,6-dibromo-3-nitropyridine |
| InChIKey | FFRFTURYWWFKIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)