CAS 221386-94-3 appears in our catalog under these names: Oseltamivir Impurity 93, Oseltamivir Impurity 111. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4S,5R)-5-azido-4-hydroxy-3-(methoxymethoxy)cyclohexene-1-carboxylate (CAS 221386-94-3) is a chemical compound with the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. IUPAC name: ethyl (3R,4S,5R)-5-azido-4-hydroxy-3-(methoxymethoxy)cyclohexene-1-carboxylate. InChIKey: VRTKQZVFRCWDDS-BBBLOLIVSA-N.
| Molecular formula | C11H17N3O5 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | ethyl (3R,4S,5R)-5-azido-4-hydroxy-3-(methoxymethoxy)cyclohexene-1-carboxylate |
| InChIKey | VRTKQZVFRCWDDS-BBBLOLIVSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@H]([C@@H](C1)N=[N+]=[N-])O)OCOC |
Computed by PubChem (NCBI)