CAS 13007-43-7 appears in our catalog under these names: N4,N4-Dimethylcytidine, >95% (HPLC), N4,N4-Dimethylcytidine. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 250mg, 1mg, 5mg, 100 mg.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one (CAS 13007-43-7) is a chemical compound with the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one. InChIKey: GFCDNWCHLZESES-PEBGCTIMSA-N.
| Molecular formula | C11H17N3O5 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one |
| InChIKey | GFCDNWCHLZESES-PEBGCTIMSA-N |
| SMILES | CN(C)C1=NC(=O)N(C=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)