Products 5984-94-1
CAS 5984-94-1 appears in our catalog under these names: Isopilocarpine Nitrate, Isopilocarpine nitrate. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg.
(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;nitric acid (CAS 5984-94-1) is a chemical compound with the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. IUPAC name: (3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;nitric acid. InChIKey: PRZXEPJJHQYOGF-KXNXZCPBSA-N.
| Molecular formula | C11H17N3O5 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | (3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one;nitric acid |
| InChIKey | PRZXEPJJHQYOGF-KXNXZCPBSA-N |
| SMILES | CC[C@@H]1[C@H](COC1=O)CC2=CN=CN2C.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)