Products 221387-44-6
CAS 221387-44-6 is the registry number for Ethyl (1R,5R,6R)-5-(methoxymethoxy)-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,5R,6R)-5-(methoxymethoxy)-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 221387-44-6) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: ethyl (1R,5R,6R)-5-(methoxymethoxy)-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: NWDUKSCTLFRVOU-OPRDCNLKSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | ethyl (1R,5R,6R)-5-(methoxymethoxy)-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | NWDUKSCTLFRVOU-OPRDCNLKSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@H]2[C@@H](C1)N2)OCOC |
Computed by PubChem (NCBI)