Products 2215-20-5
CAS 2215-20-5 is the registry number for 2-(3-Phenylthioureido)acetic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
2-(phenylcarbamothioylamino)acetic acid (CAS 2215-20-5) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 2-(phenylcarbamothioylamino)acetic acid. InChIKey: UWTLARNSDZXILM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 2-(phenylcarbamothioylamino)acetic acid |
| InChIKey | UWTLARNSDZXILM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)NCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Phenylthiohydantoic acid, N-Phenyl-N'-carboxymethylthiourea, N-Phenylthioureidoacetic acid, Glycine, N-(phenylthiocarbamoyl)-, Hydantoic acid, 1-phenyl-alpha-thio-, 1-Phenyl-alpha-thiohydantoic acid, Glycine, N-((phenylamino)thioxomethyl)-, N-[(Phenylamino)thioxomethyl]glycine, 0-12-00-00405 (Beilstein Handbook Reference), Glycine, N-[(phenylamino)thioxomethyl]-