CAS 221538-03-0 appears in our catalog under these names: (3–Bromo–2–methyl–phenyl)–carbamic acid tert–butyl ester, (3-Bromo-2-methylphenyl)carbamic acid tert-butyl ester, 97%, 97%, (3-Bromo-2-methyl-phenyl)-carbamic acid tert-butyl ester, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-(3-bromo-2-methylphenyl)carbamate (CAS 221538-03-0) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: tert-butyl N-(3-bromo-2-methylphenyl)carbamate. InChIKey: LZTCPTKWYOCEMZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-2-methylphenyl)carbamate |
| InChIKey | LZTCPTKWYOCEMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)