CAS 22162-22-7 appears in our catalog under these names: 1-Bromo-2,3-dimethyl-5-nitrobenzene 95%, 1-Bromo-2,3-dimethyl-5-nitrobenzene, 95%, 95%, 3-Bromo-4,5-dimethylnitrobenzene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 100g.
1-bromo-2,3-dimethyl-5-nitrobenzene (CAS 22162-22-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-bromo-2,3-dimethyl-5-nitrobenzene. InChIKey: DJPUAFNNWHOYMH-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-bromo-2,3-dimethyl-5-nitrobenzene |
| InChIKey | DJPUAFNNWHOYMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)