Products 2216724-49-9
CAS 2216724-49-9 is the registry number for 3,5-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2216724-49-9) is a chemical compound with the molecular formula C13H14BF2NO2 and a molecular weight of 265.07 g/mol. IUPAC name: 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: CEZQKMZXCRMBKC-UHFFFAOYSA-N.
| Molecular formula | C13H14BF2NO2 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | CEZQKMZXCRMBKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)C#N)F |
Computed by PubChem (NCBI)