Products 2996889-39-3
CAS 2996889-39-3 is the registry number for 2,5-Difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%. Offered by: Fluorochem. Available pack sizes: 100mg.
2,5-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2996889-39-3) is a chemical compound with the molecular formula C13H14BF2NO2 and a molecular weight of 265.07 g/mol. IUPAC name: 2,5-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: DFPQIDVRCFOQTN-UHFFFAOYSA-N.
| Molecular formula | C13H14BF2NO2 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 2,5-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | DFPQIDVRCFOQTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C#N)F |
Computed by PubChem (NCBI)