Products 2058322-48-6
CAS 2058322-48-6 is the registry number for 2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2058322-48-6) is a chemical compound with the molecular formula C13H14BF2NO2 and a molecular weight of 265.07 g/mol. IUPAC name: 2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: BTYLHDKJZJJXJI-UHFFFAOYSA-N.
| Molecular formula | C13H14BF2NO2 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | BTYLHDKJZJJXJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)C#N |
Computed by PubChem (NCBI)