CAS 2216747-07-6 appears in our catalog under these names: rel-Methyl (3S,4S)-4-aminotetrahydro-2H-pyran-3-carboxylate hydrochloride, 95%, rac-Methyl (3R,4R)-4-aminooxane-3-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl (3S,4S)-4-aminooxane-3-carboxylate;hydrochloride (CAS 2216747-07-6) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: methyl (3S,4S)-4-aminooxane-3-carboxylate;hydrochloride. InChIKey: FMWMGVFZENRYGU-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | methyl (3S,4S)-4-aminooxane-3-carboxylate;hydrochloride |
| InChIKey | FMWMGVFZENRYGU-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1COCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)