CAS 362490-24-2 appears in our catalog under these names: METHYL (3R,4R)-4-AMINOTETRAHYDROPYRAN-3-CARBOXYLATE HYDROCHLORIDE, 95%, 95%, Methyl (3R,4R)-4-aminotetrahydro-2H-pyran-3-carboxylate hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 5g, 1g.
Methyl (3R,4R)-4-aminooxane-3-carboxylate;hydrochloride (CAS 362490-24-2) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: methyl (3R,4R)-4-aminooxane-3-carboxylate;hydrochloride. InChIKey: FMWMGVFZENRYGU-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | methyl (3R,4R)-4-aminooxane-3-carboxylate;hydrochloride |
| InChIKey | FMWMGVFZENRYGU-RIHPBJNCSA-N |
| SMILES | COC(=O)[C@H]1COCC[C@H]1N.Cl |
Computed by PubChem (NCBI)