CAS 221699-45-2 is the registry number for 3,4-diisopropoxybenzoic acid. Offered by: TRC. Available pack sizes: 250mg.
3,4-di(propan-2-yloxy)benzoic acid (CAS 221699-45-2) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 3,4-di(propan-2-yloxy)benzoic acid. InChIKey: JDMPLLIDUJMDIX-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 3,4-di(propan-2-yloxy)benzoic acid |
| InChIKey | JDMPLLIDUJMDIX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(=O)O)OC(C)C |
Computed by PubChem (NCBI)