Products 22187-05-9
CAS 22187-05-9 is the registry number for 1-Mesitylnaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
1-(2,4,6-trimethylphenyl)naphthalene (CAS 22187-05-9) is a chemical compound with the molecular formula C19H18 and a molecular weight of 246.3 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)naphthalene. InChIKey: JSVBDBNITQVXHF-UHFFFAOYSA-N.
| Molecular formula | C19H18 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)naphthalene |
| InChIKey | JSVBDBNITQVXHF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CC=CC3=CC=CC=C32)C |
Computed by PubChem (NCBI)