CAS 852160-02-2 is the registry number for 6–Methyl–4–phenyl–1,2,3,5–tetrahydro–s–indacene. Offered by: GLPBio. Available pack sizes: 1g.
6-methyl-4-phenyl-1,2,3,5-tetrahydro-s-indacene (CAS 852160-02-2) is a chemical compound with the molecular formula C19H18 and a molecular weight of 246.3 g/mol. IUPAC name: 6-methyl-4-phenyl-1,2,3,5-tetrahydro-s-indacene. InChIKey: IWFLUEXAMNDOOL-UHFFFAOYSA-N.
| Molecular formula | C19H18 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 6-methyl-4-phenyl-1,2,3,5-tetrahydro-s-indacene |
| InChIKey | IWFLUEXAMNDOOL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C(=C3CCCC3=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)