CAS 956020-45-4 is the registry number for 2-(2,5-Dimethylbenzyl)naphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
2-[(2,5-dimethylphenyl)methyl]naphthalene (CAS 956020-45-4) is a chemical compound with the molecular formula C19H18 and a molecular weight of 246.3 g/mol. IUPAC name: 2-[(2,5-dimethylphenyl)methyl]naphthalene. InChIKey: AHIZETBUNAKGEU-UHFFFAOYSA-N.
| Molecular formula | C19H18 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2-[(2,5-dimethylphenyl)methyl]naphthalene |
| InChIKey | AHIZETBUNAKGEU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)