Products 221910-20-9
CAS 221910-20-9 is the registry number for 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
[(2R,3S,4R)-3,6-diacetyloxy-2-(hydroxymethyl)oxan-4-yl] acetate (CAS 221910-20-9) is a chemical compound with the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. IUPAC name: [(2R,3S,4R)-3,6-diacetyloxy-2-(hydroxymethyl)oxan-4-yl] acetate. InChIKey: FZAIBZCVQJIHKJ-QFEGIVONSA-N.
| Molecular formula | C12H18O8 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | [(2R,3S,4R)-3,6-diacetyloxy-2-(hydroxymethyl)oxan-4-yl] acetate |
| InChIKey | FZAIBZCVQJIHKJ-QFEGIVONSA-N |
| SMILES | CC(=O)O[C@@H]1CC(O[C@@H]([C@H]1OC(=O)C)CO)OC(=O)C |
Computed by PubChem (NCBI)