Products 2219324-32-8
CAS 2219324-32-8 appears in our catalog under these names: MDMB–CHMCZCA, Mdmb-chmczca. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
Methyl (2S)-2-[[9-(cyclohexylmethyl)carbazole-3-carbonyl]amino]-3,3-dimethylbutanoate (CAS 2219324-32-8) is a chemical compound with the molecular formula C27H34N2O3 and a molecular weight of 434.6 g/mol. IUPAC name: methyl (2S)-2-[[9-(cyclohexylmethyl)carbazole-3-carbonyl]amino]-3,3-dimethylbutanoate. InChIKey: FAWVRKNYDPKTDZ-XMMPIXPASA-N.
| Molecular formula | C27H34N2O3 |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | methyl (2S)-2-[[9-(cyclohexylmethyl)carbazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| InChIKey | FAWVRKNYDPKTDZ-XMMPIXPASA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)C1=CC2=C(C=C1)N(C3=CC=CC=C32)CC4CCCCC4 |
Computed by PubChem (NCBI)