Products 83427-83-2

CAS 83427-83-2 is the registry number for Trt-hse-oh dea, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 25g, 1g, 5g, on request.

Structural formula: {0} (CAS {1})

N-ethylethanamine;(2S)-4-hydroxy-2-(tritylamino)butanoic acid (CAS 83427-83-2) is a chemical compound with the molecular formula C27H34N2O3 and a molecular weight of 434.6 g/mol. IUPAC name: N-ethylethanamine;(2S)-4-hydroxy-2-(tritylamino)butanoic acid. InChIKey: URXRWVYGHBZAGX-BOXHHOBZSA-N.

Identity
Molecular formulaC27H34N2O3
Molecular weight434.6 g/mol
IUPAC nameN-ethylethanamine;(2S)-4-hydroxy-2-(tritylamino)butanoic acid
InChIKeyURXRWVYGHBZAGX-BOXHHOBZSA-N
SMILESCCNCC.C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N[C@@H](CCO)C(=O)O

Computed by PubChem (NCBI)