CAS 80514-77-8 is the registry number for Trt–Thr–OH·DEA. Offered by: GLPBio. Available pack sizes: 100g, 25g.
N-ethylethanamine;(2S,3R)-3-hydroxy-2-(tritylamino)butanoic acid (CAS 80514-77-8) is a chemical compound with the molecular formula C27H34N2O3 and a molecular weight of 434.6 g/mol. IUPAC name: N-ethylethanamine;(2S,3R)-3-hydroxy-2-(tritylamino)butanoic acid. InChIKey: WYYVJRBSJGUXSL-JKSHRDEXSA-N.
| Molecular formula | C27H34N2O3 |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | N-ethylethanamine;(2S,3R)-3-hydroxy-2-(tritylamino)butanoic acid |
| InChIKey | WYYVJRBSJGUXSL-JKSHRDEXSA-N |
| SMILES | CCNCC.C[C@H]([C@@H](C(=O)O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)