Products 2219331-49-2
CAS 2219331-49-2 is the registry number for 7,7-Dimethyl-2,5-dioxo-5,6,7,8-tetrahydro-2H-chromene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7,7-dimethyl-2,5-dioxo-6,8-dihydrochromene-3-carboxylic acid (CAS 2219331-49-2) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: 7,7-dimethyl-2,5-dioxo-6,8-dihydrochromene-3-carboxylic acid. InChIKey: JEMPGTZTHPKOTI-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 7,7-dimethyl-2,5-dioxo-6,8-dihydrochromene-3-carboxylic acid |
| InChIKey | JEMPGTZTHPKOTI-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=C(C(=O)O2)C(=O)O)C(=O)C1)C |
Computed by PubChem (NCBI)