Products 2219353-50-9
CAS 2219353-50-9 appears in our catalog under these names: Eliglustat Impurity 14, Eliglustat Impurity 6, Des-Hexane Eliglustat. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]acetamide (CAS 2219353-50-9) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]acetamide. InChIKey: PDNNLYAJVVWYCL-RHSMWYFYSA-N.
| Molecular formula | C17H24N2O4 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | N-[(1R,2R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]acetamide |
| InChIKey | PDNNLYAJVVWYCL-RHSMWYFYSA-N |
| SMILES | CC(=O)N[C@H](CN1CCCC1)[C@@H](C2=CC3=C(C=C2)OCCO3)O |
Computed by PubChem (NCBI)