Products 2219353-68-9

CAS 2219353-68-9 is the registry number for 2-((2R,4R)-4-Fluoropyrrolidin-2-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(2R,4R)-4-fluoropyrrolidin-2-yl]acetic acid;hydrochloride (CAS 2219353-68-9) is a chemical compound with the molecular formula C6H11ClFNO2 and a molecular weight of 183.61 g/mol. IUPAC name: 2-[(2R,4R)-4-fluoropyrrolidin-2-yl]acetic acid;hydrochloride. InChIKey: HHHUTVKCHWFLAS-JBUOLDKXSA-N.

Identity
Molecular formulaC6H11ClFNO2
Molecular weight183.61 g/mol
IUPAC name2-[(2R,4R)-4-fluoropyrrolidin-2-yl]acetic acid;hydrochloride
InChIKeyHHHUTVKCHWFLAS-JBUOLDKXSA-N
SMILESC1[C@H](CN[C@@H]1CC(=O)O)F.Cl

Computed by PubChem (NCBI)