CAS 2219354-03-5 is the registry number for (2R,3R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-phenylazetidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid (CAS 2219354-03-5) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: (2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid. InChIKey: SQMOPSBYDIMJRP-JTHBVZDNSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (2R,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid |
| InChIKey | SQMOPSBYDIMJRP-JTHBVZDNSA-N |
| SMILES | C1[C@H]([C@@H](N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)