CAS 2349339-46-2 is the registry number for (2S,3E)-2-(Fmoc-amino)-4-phenyl-3-butenoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbut-3-enoic acid (CAS 2349339-46-2) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: (E,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbut-3-enoic acid. InChIKey: ODECYMFDLLONIQ-NSFRLNINSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (E,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbut-3-enoic acid |
| InChIKey | ODECYMFDLLONIQ-NSFRLNINSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)