Products 2219378-56-8
CAS 2219378-56-8 is the registry number for rac-(3R,4S)-4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)oxolane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylic acid (CAS 2219378-56-8) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylic acid. InChIKey: SXJQMBNBCLUFOK-MSOLQXFVSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylic acid |
| InChIKey | SXJQMBNBCLUFOK-MSOLQXFVSA-N |
| SMILES | C1[C@H]([C@H](CO1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)