Products 2219408-46-3
CAS 2219408-46-3 is the registry number for 2-((tert-Butoxy)carbonyl)-6-phenyl-2-azaspiro(3.3)heptane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(2-methylpropan-2-yl)oxycarbonyl]-6-phenyl-2-azaspiro[3.3]heptane-6-carboxylic acid (CAS 2219408-46-3) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-6-phenyl-2-azaspiro[3.3]heptane-6-carboxylic acid. InChIKey: PHPQGTAXSDHJKR-UHFFFAOYSA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-6-phenyl-2-azaspiro[3.3]heptane-6-carboxylic acid |
| InChIKey | PHPQGTAXSDHJKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)