Products 22198-93-2
CAS 22198-93-2 is the registry number for A-25794. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-(2-methylbut-3-yn-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (CAS 22198-93-2) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: (E)-N-(2-methylbut-3-yn-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide. InChIKey: APIXMWJMJACVBU-CMDGGOBGSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (E)-N-(2-methylbut-3-yn-2-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| InChIKey | APIXMWJMJACVBU-CMDGGOBGSA-N |
| SMILES | CC(C)(C#C)NC(=O)/C=C/C1=CC(=C(C(=C1)OC)OC)OC |
Computed by PubChem (NCBI)