CAS 222036-53-5 appears in our catalog under these names: 5-(Methylsulfonyl)indoline-2,3-dione, 98%, 5-(Methylsulfonyl)indoline-2,3-dione, 95%, 95%, 5-Methanesulfonyl-2,3-dihydro-1H-indole-2,3-dione, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg.
5-methylsulfonyl-1H-indole-2,3-dione (CAS 222036-53-5) is a chemical compound with the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. IUPAC name: 5-methylsulfonyl-1H-indole-2,3-dione. InChIKey: AWBYFLQIQGVIPZ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4S |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 5-methylsulfonyl-1H-indole-2,3-dione |
| InChIKey | AWBYFLQIQGVIPZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)