Products 797035-88-2

CAS 797035-88-2 is the registry number for 4-(Cyanomethanesulfonyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-(cyanomethylsulfonyl)benzoic acid (CAS 797035-88-2) is a chemical compound with the molecular formula C9H7NO4S and a molecular weight of 225.22 g/mol. IUPAC name: 4-(cyanomethylsulfonyl)benzoic acid. InChIKey: IVXJYJZFHMSMGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO4S
Molecular weight225.22 g/mol
IUPAC name4-(cyanomethylsulfonyl)benzoic acid
InChIKeyIVXJYJZFHMSMGZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)S(=O)(=O)CC#N

Computed by PubChem (NCBI)